C17H17BrFN3O — CID 167838985
4-bromo-3-fluoro-N-(4-piperazin-1-ylphenyl)benzamide (PubChem CID 167838985) has the molecular formula C17H17BrFN3O and a molecular weight of 378.25 g/mol. Its IUPAC name is 4-bromo-3-fluoro-N-(4-piperazin-1-ylphenyl)benzamide.
| Compound Name | 4-bromo-3-fluoro-N-(4-piperazin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 167838985 |
| Molecular Formula | C17H17BrFN3O |
| Molecular Weight | 378.25 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 4-bromo-3-fluoro-N-(4-piperazin-1-ylphenyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCNCC2)cc1)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C17H17BrFN3O/c18-15-6-1-12(11-16(15)19)17(23)21-13-2-4-14(5-3-13)22-9-7-20-8-10-22/h1-6,11,20H,7-10H2,(H,21,23) |
| InChIKey | HBJMPYDRTZSYLY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|