C16H25BrN2O3 — CID 174928802
(2-bromo-5-piperazin-1-ylphenyl)methanol;tert-butyl formate (PubChem CID 174928802) has the molecular formula C16H25BrN2O3 and a molecular weight of 373.29 g/mol. Its IUPAC name is (2-bromo-5-piperazin-1-ylphenyl)methanol;tert-butyl formate.
| Compound Name | (2-bromo-5-piperazin-1-ylphenyl)methanol;tert-butyl formate |
|---|---|
| PubChem CID | 174928802 |
| Molecular Formula | C16H25BrN2O3 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | (2-bromo-5-piperazin-1-ylphenyl)methanol;tert-butyl formate |
| SMILES | CC(C)(C)OC=O.OCc1cc(N2CCNCC2)ccc1Br |
| InChI | InChI=1S/C11H15BrN2O.C5H10O2/c12-11-2-1-10(7-9(11)8-15)14-5-3-13-4-6-14;1-5(2,3)7-4-6/h1-2,7,13,15H,3-6,8H2;4H,1-3H3 |
| InChIKey | NDKYZYAEGLJQGZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|