C18H28N4O2 — CID 159945137
tert-butyl formate;3-ethyl-6-piperazin-1-yl-2H-indazole (PubChem CID 159945137) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is tert-butyl formate;3-ethyl-6-piperazin-1-yl-2H-indazole.
| Compound Name | tert-butyl formate;3-ethyl-6-piperazin-1-yl-2H-indazole |
|---|---|
| PubChem CID | 159945137 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | tert-butyl formate;3-ethyl-6-piperazin-1-yl-2H-indazole |
| SMILES | CC(C)(C)OC=O.CCc1[nH]nc2cc(N3CCNCC3)ccc12 |
| InChI | InChI=1S/C13H18N4.C5H10O2/c1-2-12-11-4-3-10(9-13(11)16-15-12)17-7-5-14-6-8-17;1-5(2,3)7-4-6/h3-4,9,14H,2,5-8H2,1H3,(H,15,16);4H,1-3H3 |
| InChIKey | OBJQPVSXNAFPOS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|