C16H27N3O3 — CID 159836584
tert-butyl formate;2-methoxy-5-piperazin-1-ylaniline (PubChem CID 159836584) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is tert-butyl formate;2-methoxy-5-piperazin-1-ylaniline.
| Compound Name | tert-butyl formate;2-methoxy-5-piperazin-1-ylaniline |
|---|---|
| PubChem CID | 159836584 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | tert-butyl formate;2-methoxy-5-piperazin-1-ylaniline |
| SMILES | CC(C)(C)OC=O.COc1ccc(N2CCNCC2)cc1N |
| InChI | InChI=1S/C11H17N3O.C5H10O2/c1-15-11-3-2-9(8-10(11)12)14-6-4-13-5-7-14;1-5(2,3)7-4-6/h2-3,8,13H,4-7,12H2,1H3;4H,1-3H3 |
| InChIKey | NODNZQQLWBJGTI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|