C26H31FN4O3 — CID 157133400
tert-butyl formate;3-fluoro-4-[[3-(4-piperazin-1-ylphenyl)-4-pyridinyl]oxy]aniline (PubChem CID 157133400) has the molecular formula C26H31FN4O3 and a molecular weight of 466.56 g/mol. Its IUPAC name is tert-butyl formate;3-fluoro-4-[[3-(4-piperazin-1-ylphenyl)-4-pyridinyl]oxy]aniline.
| Compound Name | tert-butyl formate;3-fluoro-4-[[3-(4-piperazin-1-ylphenyl)-4-pyridinyl]oxy]aniline |
|---|---|
| PubChem CID | 157133400 |
| Molecular Formula | C26H31FN4O3 |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | tert-butyl formate;3-fluoro-4-[[3-(4-piperazin-1-ylphenyl)-4-pyridinyl]oxy]aniline |
| SMILES | CC(C)(C)OC=O.Nc1ccc(Oc2ccncc2-c2ccc(N3CCNCC3)cc2)c(F)c1 |
| InChI | InChI=1S/C21H21FN4O.C5H10O2/c22-19-13-16(23)3-6-21(19)27-20-7-8-25-14-18(20)15-1-4-17(5-2-15)26-11-9-24-10-12-26;1-5(2,3)7-4-6/h1-8,13-14,24H,9-12,23H2;4H,1-3H3 |
| InChIKey | AJIJYHGMNPVPQW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|