C19H22BrFN3O+ — CID 6979251
N-(4-bromo-3-methylphenyl)-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 6979251) has the molecular formula C19H22BrFN3O+ and a molecular weight of 407.31 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 6979251 |
| Molecular Formula | C19H22BrFN3O+ |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | Cc1cc(NC(=O)C[NH+]2CCN(c3ccc(F)cc3)CC2)ccc1Br |
| InChI | InChI=1S/C19H21BrFN3O/c1-14-12-16(4-7-18(14)20)22-19(25)13-23-8-10-24(11-9-23)17-5-2-15(21)3-6-17/h2-7,12H,8-11,13H2,1H3,(H,22,25)/p+1 |
| InChIKey | PGNQXTZKCIWERH-UHFFFAOYSA-O |
| XLogP | 2.24 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |