C18H19Cl2FN3O+ — CID 6958471
N-(3,5-dichlorophenyl)-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 6958471) has the molecular formula C18H19Cl2FN3O+ and a molecular weight of 383.27 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 6958471 |
| Molecular Formula | C18H19Cl2FN3O+ |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | O=C(C[NH+]1CCN(c2ccc(F)cc2)CC1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H18Cl2FN3O/c19-13-9-14(20)11-16(10-13)22-18(25)12-23-5-7-24(8-6-23)17-3-1-15(21)2-4-17/h1-4,9-11H,5-8,12H2,(H,22,25)/p+1 |
| InChIKey | PQZKKGGFNRVBBA-UHFFFAOYSA-O |
| XLogP | 2.48 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |