C25H24ClFN3O2+ — CID 2172531
N-(2-benzoyl-4-chlorophenyl)-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 2172531) has the molecular formula C25H24ClFN3O2+ and a molecular weight of 452.94 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 2172531 |
| Molecular Formula | C25H24ClFN3O2+ |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | O=C(C[NH+]1CCN(c2ccc(F)cc2)CC1)Nc1ccc(Cl)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H23ClFN3O2/c26-19-6-11-23(22(16-19)25(32)18-4-2-1-3-5-18)28-24(31)17-29-12-14-30(15-13-29)21-9-7-20(27)8-10-21/h1-11,16H,12-15,17H2,(H,28,31)/p+1 |
| InChIKey | UMDABCNEYHGIPN-UHFFFAOYSA-O |
| XLogP | 3.05 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |