C22H24ClN2O4+ — CID 7986996
methyl 1-[2-(2-benzoyl-4-chloroanilino)-2-oxoethyl]piperidin-1-ium-4-carboxylate (PubChem CID 7986996) has the molecular formula C22H24ClN2O4+ and a molecular weight of 415.90 g/mol. Its IUPAC name is methyl 1-[2-(2-benzoyl-4-chloroanilino)-2-oxoethyl]piperidin-1-ium-4-carboxylate.
| Compound Name | methyl 1-[2-(2-benzoyl-4-chloroanilino)-2-oxoethyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 7986996 |
| Molecular Formula | C22H24ClN2O4+ |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | methyl 1-[2-(2-benzoyl-4-chloroanilino)-2-oxoethyl]piperidin-1-ium-4-carboxylate |
| SMILES | COC(=O)C1CC[NH+](CC(=O)Nc2ccc(Cl)cc2C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H23ClN2O4/c1-29-22(28)16-9-11-25(12-10-16)14-20(26)24-19-8-7-17(23)13-18(19)21(27)15-5-3-2-4-6-15/h2-8,13,16H,9-12,14H2,1H3,(H,24,26)/p+1 |
| InChIKey | QZXIBZISOHSZRY-UHFFFAOYSA-O |
| XLogP | 1.98 |
| TPSA | 76.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |