C16H23N2O5S+ — CID 8754732
methyl 1-[2-(2-methylsulfonylanilino)-2-oxoethyl]piperidin-1-ium-4-carboxylate (PubChem CID 8754732) has the molecular formula C16H23N2O5S+ and a molecular weight of 355.44 g/mol. Its IUPAC name is methyl 1-[2-(2-methylsulfonylanilino)-2-oxoethyl]piperidin-1-ium-4-carboxylate.
| Compound Name | methyl 1-[2-(2-methylsulfonylanilino)-2-oxoethyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 8754732 |
| Molecular Formula | C16H23N2O5S+ |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | methyl 1-[2-(2-methylsulfonylanilino)-2-oxoethyl]piperidin-1-ium-4-carboxylate |
| SMILES | COC(=O)C1CC[NH+](CC(=O)Nc2ccccc2S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C16H22N2O5S/c1-23-16(20)12-7-9-18(10-8-12)11-15(19)17-13-5-3-4-6-14(13)24(2,21)22/h3-6,12H,7-11H2,1-2H3,(H,17,19)/p+1 |
| InChIKey | KKLIVLQVJZNRCY-UHFFFAOYSA-O |
| XLogP | -0.50 |
| TPSA | 93.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |