C16H22BrN2O3+ — CID 8741823
methyl 1-[2-(4-bromo-2-methylanilino)-2-oxoethyl]piperidin-1-ium-4-carboxylate (PubChem CID 8741823) has the molecular formula C16H22BrN2O3+ and a molecular weight of 370.27 g/mol. Its IUPAC name is methyl 1-[2-(4-bromo-2-methylanilino)-2-oxoethyl]piperidin-1-ium-4-carboxylate.
| Compound Name | methyl 1-[2-(4-bromo-2-methylanilino)-2-oxoethyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 8741823 |
| Molecular Formula | C16H22BrN2O3+ |
| Molecular Weight | 370.27 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | methyl 1-[2-(4-bromo-2-methylanilino)-2-oxoethyl]piperidin-1-ium-4-carboxylate |
| SMILES | COC(=O)C1CC[NH+](CC(=O)Nc2ccc(Br)cc2C)CC1 |
| InChI | InChI=1S/C16H21BrN2O3/c1-11-9-13(17)3-4-14(11)18-15(20)10-19-7-5-12(6-8-19)16(21)22-2/h3-4,9,12H,5-8,10H2,1-2H3,(H,18,20)/p+1 |
| InChIKey | JBCWMPNUZRWOQD-UHFFFAOYSA-O |
| XLogP | 1.16 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |