C14H19ClN3O3+ — CID 8555347
methyl 1-[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]piperidin-1-ium-4-carboxylate (PubChem CID 8555347) has the molecular formula C14H19ClN3O3+ and a molecular weight of 312.78 g/mol. Its IUPAC name is methyl 1-[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]piperidin-1-ium-4-carboxylate.
| Compound Name | methyl 1-[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 8555347 |
| Molecular Formula | C14H19ClN3O3+ |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | methyl 1-[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]piperidin-1-ium-4-carboxylate |
| SMILES | COC(=O)C1CC[NH+](CC(=O)Nc2cccnc2Cl)CC1 |
| InChI | InChI=1S/C14H18ClN3O3/c1-21-14(20)10-4-7-18(8-5-10)9-12(19)17-11-3-2-6-16-13(11)15/h2-3,6,10H,4-5,7-9H2,1H3,(H,17,19)/p+1 |
| InChIKey | BNYIMNPLYUDNNG-UHFFFAOYSA-O |
| XLogP | 0.14 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|