C17H20ClN4O2+ — CID 2460298
N-(2-chloro-3-pyridinyl)-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 2460298) has the molecular formula C17H20ClN4O2+ and a molecular weight of 347.83 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 2460298 |
| Molecular Formula | C17H20ClN4O2+ |
| Molecular Weight | 347.83 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | O=C(C[NH+]1CCN(c2ccccc2O)CC1)Nc1cccnc1Cl |
| InChI | InChI=1S/C17H19ClN4O2/c18-17-13(4-3-7-19-17)20-16(24)12-21-8-10-22(11-9-21)14-5-1-2-6-15(14)23/h1-7,23H,8-12H2,(H,20,24)/p+1 |
| InChIKey | IQCIAMQLXSSYJV-UHFFFAOYSA-O |
| XLogP | 0.78 |
| TPSA | 69.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.83 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|