C19H22ClN4O3S+ — CID 8553819
N-(2-chloro-3-pyridinyl)-2-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-ium-1-yl]acetamide (PubChem CID 8553819) has the molecular formula C19H22ClN4O3S+ and a molecular weight of 421.93 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8553819 |
| Molecular Formula | C19H22ClN4O3S+ |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-ium-1-yl]acetamide |
| SMILES | O=C(C[NH+]1CCN(S(=O)(=O)/C=C/c2ccccc2)CC1)Nc1cccnc1Cl |
| InChI | InChI=1S/C19H21ClN4O3S/c20-19-17(7-4-9-21-19)22-18(25)15-23-10-12-24(13-11-23)28(26,27)14-8-16-5-2-1-3-6-16/h1-9,14H,10-13,15H2,(H,22,25)/p+1/b14-8+ |
| InChIKey | KFSNXMRUGUZQBS-RIYZIHGNSA-O |
| XLogP | 0.87 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|