C12H17ClN3O+ — CID 7784525
N-(2-chloro-3-pyridinyl)-2-piperidin-1-ium-1-ylacetamide (PubChem CID 7784525) has the molecular formula C12H17ClN3O+ and a molecular weight of 254.74 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-piperidin-1-ium-1-ylacetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-piperidin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 7784525 |
| Molecular Formula | C12H17ClN3O+ |
| Molecular Weight | 254.74 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-piperidin-1-ium-1-ylacetamide |
| SMILES | O=C(C[NH+]1CCCCC1)Nc1cccnc1Cl |
| InChI | InChI=1S/C12H16ClN3O/c13-12-10(5-4-6-14-12)15-11(17)9-16-7-2-1-3-8-16/h4-6H,1-3,7-9H2,(H,15,17)/p+1 |
| InChIKey | OOOCTOKZMYDBEF-UHFFFAOYSA-O |
| XLogP | 0.74 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.74 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|