C8H10ClN3O — CID 43222204
N-(2-chloro-3-pyridinyl)-2-(methylamino)acetamide (PubChem CID 43222204) has the molecular formula C8H10ClN3O and a molecular weight of 199.64 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-(methylamino)acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 43222204 |
| Molecular Formula | C8H10ClN3O |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-(methylamino)acetamide |
| SMILES | CNCC(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C8H10ClN3O/c1-10-5-7(13)12-6-3-2-4-11-8(6)9/h2-4,10H,5H2,1H3,(H,12,13) |
| InChIKey | FGWXJEBIYGQLJB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|