C17H19ClN2OS — CID 18276902
N-(2-chloro-3-pyridinyl)-2-(2,3,5,6-tetramethylphenyl)sulfanylacetamide (PubChem CID 18276902) has the molecular formula C17H19ClN2OS and a molecular weight of 334.87 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-(2,3,5,6-tetramethylphenyl)sulfanylacetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-(2,3,5,6-tetramethylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 18276902 |
| Molecular Formula | C17H19ClN2OS |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-(2,3,5,6-tetramethylphenyl)sulfanylacetamide |
| SMILES | Cc1cc(C)c(C)c(SCC(=O)Nc2cccnc2Cl)c1C |
| InChI | InChI=1S/C17H19ClN2OS/c1-10-8-11(2)13(4)16(12(10)3)22-9-15(21)20-14-6-5-7-19-17(14)18/h5-8H,9H2,1-4H3,(H,20,21) |
| InChIKey | CHARXHWYJHPDQL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|