C14H13ClN6OS — CID 7940299
N-(2-chloro-3-pyridinyl)-2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetamide (PubChem CID 7940299) has the molecular formula C14H13ClN6OS and a molecular weight of 348.82 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 7940299 |
| Molecular Formula | C14H13ClN6OS |
| Molecular Weight | 348.82 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetamide |
| SMILES | Cc1cc(C)n2c(SCC(=O)Nc3cccnc3Cl)nnc2n1 |
| InChI | InChI=1S/C14H13ClN6OS/c1-8-6-9(2)21-13(17-8)19-20-14(21)23-7-11(22)18-10-4-3-5-16-12(10)15/h3-6H,7H2,1-2H3,(H,18,22) |
| InChIKey | HUGLHBMAOUSELS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.82 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|