C12H15ClN6OS — CID 36795150
N-(2-chloro-3-pyridinyl)-2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 36795150) has the molecular formula C12H15ClN6OS and a molecular weight of 326.81 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 36795150 |
| Molecular Formula | C12H15ClN6OS |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | CC(C)Cn1nnnc1SCC(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C12H15ClN6OS/c1-8(2)6-19-12(16-17-18-19)21-7-10(20)15-9-4-3-5-14-11(9)13/h3-5,8H,6-7H2,1-2H3,(H,15,20) |
| InChIKey | KRERLOSSCBYZEC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|