C11H9ClF3N5OS — CID 3894408
N-(2-chloro-3-pyridinyl)-2-[[4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 3894408) has the molecular formula C11H9ClF3N5OS and a molecular weight of 351.74 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[[4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[[4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3894408 |
| Molecular Formula | C11H9ClF3N5OS |
| Molecular Weight | 351.74 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[[4-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cn1c(SCC(=O)Nc2cccnc2Cl)nnc1C(F)(F)F |
| InChI | InChI=1S/C11H9ClF3N5OS/c1-20-9(11(13,14)15)18-19-10(20)22-5-7(21)17-6-3-2-4-16-8(6)12/h2-4H,5H2,1H3,(H,17,21) |
| InChIKey | VKZBDIPJALVPRP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.74 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|