C17H16ClN5OS — CID 2530193
2-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide (PubChem CID 2530193) has the molecular formula C17H16ClN5OS and a molecular weight of 373.87 g/mol. Its IUPAC name is 2-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide.
| Compound Name | 2-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 2530193 |
| Molecular Formula | C17H16ClN5OS |
| Molecular Weight | 373.87 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 2-[(4-benzyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide |
| SMILES | Cc1nnc(SCC(=O)Nc2cccnc2Cl)n1Cc1ccccc1 |
| InChI | InChI=1S/C17H16ClN5OS/c1-12-21-22-17(23(12)10-13-6-3-2-4-7-13)25-11-15(24)20-14-8-5-9-19-16(14)18/h2-9H,10-11H2,1H3,(H,20,24) |
| InChIKey | GCVNWKSSNIGCKV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.87 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|