C12H15ClN6OS — CID 65294412
2-[[4-(2-aminoethyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide (PubChem CID 65294412) has the molecular formula C12H15ClN6OS and a molecular weight of 326.81 g/mol. Its IUPAC name is 2-[[4-(2-aminoethyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide.
| Compound Name | 2-[[4-(2-aminoethyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 65294412 |
| Molecular Formula | C12H15ClN6OS |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 2-[[4-(2-aminoethyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide |
| SMILES | Cc1nnc(SCC(=O)Nc2cccnc2Cl)n1CCN |
| InChI | InChI=1S/C12H15ClN6OS/c1-8-17-18-12(19(8)6-4-14)21-7-10(20)16-9-3-2-5-15-11(9)13/h2-3,5H,4,6-7,14H2,1H3,(H,16,20) |
| InChIKey | AKRCYIIUNHATNE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|