C21H25ClN6OS — CID 19641943
N-(2-chloro-3-pyridinyl)-2-[[5-[4-(diethylamino)phenyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19641943) has the molecular formula C21H25ClN6OS and a molecular weight of 444.99 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[[5-[4-(diethylamino)phenyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[[5-[4-(diethylamino)phenyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19641943 |
| Molecular Formula | C21H25ClN6OS |
| Molecular Weight | 444.99 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[[5-[4-(diethylamino)phenyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCN(CC)c1ccc(-c2nnc(SCC(=O)Nc3cccnc3Cl)n2CC)cc1 |
| InChI | InChI=1S/C21H25ClN6OS/c1-4-27(5-2)16-11-9-15(10-12-16)20-25-26-21(28(20)6-3)30-14-18(29)24-17-8-7-13-23-19(17)22/h7-13H,4-6,14H2,1-3H3,(H,24,29) |
| InChIKey | CIUPAAYMDIWVSQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.99 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|