C21H24ClN5O2S — CID 19732704
2-[[5-(4-butoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide (PubChem CID 19732704) has the molecular formula C21H24ClN5O2S and a molecular weight of 445.98 g/mol. Its IUPAC name is 2-[[5-(4-butoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide.
| Compound Name | 2-[[5-(4-butoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 19732704 |
| Molecular Formula | C21H24ClN5O2S |
| Molecular Weight | 445.98 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 2-[[5-(4-butoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide |
| SMILES | CCCCOc1ccc(-c2nnc(SCC(=O)Nc3cccnc3Cl)n2CC)cc1 |
| InChI | InChI=1S/C21H24ClN5O2S/c1-3-5-13-29-16-10-8-15(9-11-16)20-25-26-21(27(20)4-2)30-14-18(28)24-17-7-6-12-23-19(17)22/h6-12H,3-5,13-14H2,1-2H3,(H,24,28) |
| InChIKey | REQFDMLLGOZAPY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.98 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|