C22H26ClN5O2S — CID 17380699
2-[[5-[(4-tert-butylphenoxy)methyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide (PubChem CID 17380699) has the molecular formula C22H26ClN5O2S and a molecular weight of 460.00 g/mol. Its IUPAC name is 2-[[5-[(4-tert-butylphenoxy)methyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide.
| Compound Name | 2-[[5-[(4-tert-butylphenoxy)methyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 17380699 |
| Molecular Formula | C22H26ClN5O2S |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 2-[[5-[(4-tert-butylphenoxy)methyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide |
| SMILES | CCn1c(COc2ccc(C(C)(C)C)cc2)nnc1SCC(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C22H26ClN5O2S/c1-5-28-18(13-30-16-10-8-15(9-11-16)22(2,3)4)26-27-21(28)31-14-19(29)25-17-7-6-12-24-20(17)23/h6-12H,5,13-14H2,1-4H3,(H,25,29) |
| InChIKey | UAYDDECHDDAQJS-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|