C19H20ClN5O3S — CID 19731057
N-(2-chloro-3-pyridinyl)-2-[[5-(3,4-dimethoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19731057) has the molecular formula C19H20ClN5O3S and a molecular weight of 433.92 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[[5-(3,4-dimethoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[[5-(3,4-dimethoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19731057 |
| Molecular Formula | C19H20ClN5O3S |
| Molecular Weight | 433.92 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[[5-(3,4-dimethoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCn1c(SCC(=O)Nc2cccnc2Cl)nnc1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H20ClN5O3S/c1-4-25-18(12-7-8-14(27-2)15(10-12)28-3)23-24-19(25)29-11-16(26)22-13-6-5-9-21-17(13)20/h5-10H,4,11H2,1-3H3,(H,22,26) |
| InChIKey | CBALCYVJSXEDBN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.92 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|