C19H23N5O2S2 — CID 19732684
2-[[5-(4-butoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 19732684) has the molecular formula C19H23N5O2S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is 2-[[5-(4-butoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[[5-(4-butoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 19732684 |
| Molecular Formula | C19H23N5O2S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 2-[[5-(4-butoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | CCCCOc1ccc(-c2nnc(SCC(=O)Nc3nccs3)n2CC)cc1 |
| InChI | InChI=1S/C19H23N5O2S2/c1-3-5-11-26-15-8-6-14(7-9-15)17-22-23-19(24(17)4-2)28-13-16(25)21-18-20-10-12-27-18/h6-10,12H,3-5,11,13H2,1-2H3,(H,20,21,25) |
| InChIKey | UPCCXRCBDRELJA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|