C23H24Cl3N5OS — CID 19642046
2-[[5-[4-(diethylamino)phenyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 19642046) has the molecular formula C23H24Cl3N5OS and a molecular weight of 524.91 g/mol. Its IUPAC name is 2-[[5-[4-(diethylamino)phenyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[[5-[4-(diethylamino)phenyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 19642046 |
| Molecular Formula | C23H24Cl3N5OS |
| Molecular Weight | 524.91 g/mol |
| Exact Mass | 523.08 |
| IUPAC Name | 2-[[5-[4-(diethylamino)phenyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)nnc1-c1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C23H24Cl3N5OS/c1-4-11-31-22(15-7-9-16(10-8-15)30(5-2)6-3)28-29-23(31)33-14-21(32)27-20-13-18(25)17(24)12-19(20)26/h4,7-10,12-13H,1,5-6,11,14H2,2-3H3,(H,27,32) |
| InChIKey | GGDFAULFPGBEBL-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.91 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|