C17H12BrCl3N4O2S — CID 19724974
2-[[5-(5-bromofuran-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 19724974) has the molecular formula C17H12BrCl3N4O2S and a molecular weight of 522.64 g/mol. Its IUPAC name is 2-[[5-(5-bromofuran-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[[5-(5-bromofuran-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 19724974 |
| Molecular Formula | C17H12BrCl3N4O2S |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 519.89 |
| IUPAC Name | 2-[[5-(5-bromofuran-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)nnc1-c1ccc(Br)o1 |
| InChI | InChI=1S/C17H12BrCl3N4O2S/c1-2-5-25-16(13-3-4-14(18)27-13)23-24-17(25)28-8-15(26)22-12-7-10(20)9(19)6-11(12)21/h2-4,6-7H,1,5,8H2,(H,22,26) |
| InChIKey | BRZIYBBIEWCADL-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|