C20H17Cl3N4O2S — CID 17301660
2-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 17301660) has the molecular formula C20H17Cl3N4O2S and a molecular weight of 483.81 g/mol. Its IUPAC name is 2-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 17301660 |
| Molecular Formula | C20H17Cl3N4O2S |
| Molecular Weight | 483.81 g/mol |
| Exact Mass | 482.01 |
| IUPAC Name | 2-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)nnc1-c1ccccc1OC |
| InChI | InChI=1S/C20H17Cl3N4O2S/c1-3-8-27-19(12-6-4-5-7-17(12)29-2)25-26-20(27)30-11-18(28)24-16-10-14(22)13(21)9-15(16)23/h3-7,9-10H,1,8,11H2,2H3,(H,24,28) |
| InChIKey | LGOJTTNQIUBZHO-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.81 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|