C21H20ClN5O3S — CID 55319320
2-chloro-N'-[2-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide (PubChem CID 55319320) has the molecular formula C21H20ClN5O3S and a molecular weight of 457.94 g/mol. Its IUPAC name is 2-chloro-N'-[2-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide.
| Compound Name | 2-chloro-N'-[2-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 55319320 |
| Molecular Formula | C21H20ClN5O3S |
| Molecular Weight | 457.94 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 2-chloro-N'-[2-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]benzohydrazide |
| SMILES | C=CCn1c(SCC(=O)NNC(=O)c2ccccc2Cl)nnc1-c1ccccc1OC |
| InChI | InChI=1S/C21H20ClN5O3S/c1-3-12-27-19(15-9-5-7-11-17(15)30-2)24-26-21(27)31-13-18(28)23-25-20(29)14-8-4-6-10-16(14)22/h3-11H,1,12-13H2,2H3,(H,23,28)(H,25,29) |
| InChIKey | WABQFWHMCMAQRG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.94 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|