C20H17Cl2N3O2S — CID 4786260
2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-(2-methoxyphenyl)ethanone (PubChem CID 4786260) has the molecular formula C20H17Cl2N3O2S and a molecular weight of 434.35 g/mol. Its IUPAC name is 2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-(2-methoxyphenyl)ethanone.
| Compound Name | 2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-(2-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 4786260 |
| Molecular Formula | C20H17Cl2N3O2S |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | 2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-(2-methoxyphenyl)ethanone |
| SMILES | C=CCn1c(SCC(=O)c2ccccc2OC)nnc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H17Cl2N3O2S/c1-3-10-25-19(14-9-8-13(21)11-16(14)22)23-24-20(25)28-12-17(26)15-6-4-5-7-18(15)27-2/h3-9,11H,1,10,12H2,2H3 |
| InChIKey | RSFOGCGWIYSHHH-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|