C14H13Cl2N5O2S — CID 7725680
N-carbamoyl-2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 7725680) has the molecular formula C14H13Cl2N5O2S and a molecular weight of 386.26 g/mol. Its IUPAC name is N-carbamoyl-2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-carbamoyl-2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 7725680 |
| Molecular Formula | C14H13Cl2N5O2S |
| Molecular Weight | 386.26 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | N-carbamoyl-2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)NC(N)=O)nnc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H13Cl2N5O2S/c1-2-5-21-12(9-4-3-8(15)6-10(9)16)19-20-14(21)24-7-11(22)18-13(17)23/h2-4,6H,1,5,7H2,(H3,17,18,22,23) |
| InChIKey | SGOFVZUMDUZFHY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|