C22H22Cl2N4OS — CID 21378459
2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-propan-2-ylphenyl)acetamide (PubChem CID 21378459) has the molecular formula C22H22Cl2N4OS and a molecular weight of 461.42 g/mol. Its IUPAC name is 2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 21378459 |
| Molecular Formula | C22H22Cl2N4OS |
| Molecular Weight | 461.42 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-propan-2-ylphenyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccccc2C(C)C)nnc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H22Cl2N4OS/c1-4-11-28-21(17-10-9-15(23)12-18(17)24)26-27-22(28)30-13-20(29)25-19-8-6-5-7-16(19)14(2)3/h4-10,12,14H,1,11,13H2,2-3H3,(H,25,29) |
| InChIKey | BHRJHKJKIHEQKM-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.42 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|