C19H14Cl4N4OS — CID 21378468
N-(2,3-dichlorophenyl)-2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 21378468) has the molecular formula C19H14Cl4N4OS and a molecular weight of 488.23 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 21378468 |
| Molecular Formula | C19H14Cl4N4OS |
| Molecular Weight | 488.23 g/mol |
| Exact Mass | 485.96 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cccc(Cl)c2Cl)nnc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H14Cl4N4OS/c1-2-8-27-18(12-7-6-11(20)9-14(12)22)25-26-19(27)29-10-16(28)24-15-5-3-4-13(21)17(15)23/h2-7,9H,1,8,10H2,(H,24,28) |
| InChIKey | QFROKKVUSWZCHP-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.23 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|