C20H17BrCl2N4OS — CID 21378487
N-(4-bromo-2-methylphenyl)-2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 21378487) has the molecular formula C20H17BrCl2N4OS and a molecular weight of 512.26 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 21378487 |
| Molecular Formula | C20H17BrCl2N4OS |
| Molecular Weight | 512.26 g/mol |
| Exact Mass | 509.97 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(Br)cc2C)nnc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H17BrCl2N4OS/c1-3-8-27-19(15-6-5-14(22)10-16(15)23)25-26-20(27)29-11-18(28)24-17-7-4-13(21)9-12(17)2/h3-7,9-10H,1,8,11H2,2H3,(H,24,28) |
| InChIKey | GBQYXRMJTWGZSG-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.26 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|