C16H19BrN4OS — CID 17136522
N-(4-bromo-2-methylphenyl)-2-[(5-ethyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 17136522) has the molecular formula C16H19BrN4OS and a molecular weight of 395.33 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-2-[(5-ethyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-2-[(5-ethyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 17136522 |
| Molecular Formula | C16H19BrN4OS |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-2-[(5-ethyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | C=CCn1c(CC)nnc1SCC(=O)Nc1ccc(Br)cc1C |
| InChI | InChI=1S/C16H19BrN4OS/c1-4-8-21-14(5-2)19-20-16(21)23-10-15(22)18-13-7-6-12(17)9-11(13)3/h4,6-7,9H,1,5,8,10H2,2-3H3,(H,18,22) |
| InChIKey | YURNTZXWJUIOPO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|