C20H18BrN5O4S — CID 2979492
2-[[5-(5-bromo-2-hydroxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-4-nitrophenyl)acetamide (PubChem CID 2979492) has the molecular formula C20H18BrN5O4S and a molecular weight of 504.37 g/mol. Its IUPAC name is 2-[[5-(5-bromo-2-hydroxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-4-nitrophenyl)acetamide.
| Compound Name | 2-[[5-(5-bromo-2-hydroxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 2979492 |
| Molecular Formula | C20H18BrN5O4S |
| Molecular Weight | 504.37 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | 2-[[5-(5-bromo-2-hydroxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-4-nitrophenyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc([N+](=O)[O-])cc2C)nnc1-c1cc(Br)ccc1O |
| InChI | InChI=1S/C20H18BrN5O4S/c1-3-8-25-19(15-10-13(21)4-7-17(15)27)23-24-20(25)31-11-18(28)22-16-6-5-14(26(29)30)9-12(16)2/h3-7,9-10,27H,1,8,11H2,2H3,(H,22,28) |
| InChIKey | KZUYTXMIFROYFZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 123.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|