C23H24BrN5O2S — CID 126361393
N-[(1S)-1-[5-[2-(4-bromo-2-methylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 126361393) has the molecular formula C23H24BrN5O2S and a molecular weight of 514.45 g/mol. Its IUPAC name is N-[(1S)-1-[5-[2-(4-bromo-2-methylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | N-[(1S)-1-[5-[2-(4-bromo-2-methylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 126361393 |
| Molecular Formula | C23H24BrN5O2S |
| Molecular Weight | 514.45 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | N-[(1S)-1-[5-[2-(4-bromo-2-methylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(Br)cc2C)nnc1[C@H](C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H24BrN5O2S/c1-4-12-29-21(16(3)25-22(31)17-8-6-5-7-9-17)27-28-23(29)32-14-20(30)26-19-11-10-18(24)13-15(19)2/h4-11,13,16H,1,12,14H2,2-3H3,(H,25,31)(H,26,30)/t16-/m0/s1 |
| InChIKey | DTZCNZYNVCZIOB-INIZCTEOSA-N |
| XLogP | 4.76 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|