C25H28IN5O2S — CID 126349222
N-[(1S)-1-[5-[2-(4-iodo-2-propan-2-ylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 126349222) has the molecular formula C25H28IN5O2S and a molecular weight of 589.50 g/mol. Its IUPAC name is N-[(1S)-1-[5-[2-(4-iodo-2-propan-2-ylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | N-[(1S)-1-[5-[2-(4-iodo-2-propan-2-ylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 126349222 |
| Molecular Formula | C25H28IN5O2S |
| Molecular Weight | 589.50 g/mol |
| Exact Mass | 589.10 |
| IUPAC Name | N-[(1S)-1-[5-[2-(4-iodo-2-propan-2-ylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(I)cc2C(C)C)nnc1[C@H](C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H28IN5O2S/c1-5-13-31-23(17(4)27-24(33)18-9-7-6-8-10-18)29-30-25(31)34-15-22(32)28-21-12-11-19(26)14-20(21)16(2)3/h5-12,14,16-17H,1,13,15H2,2-4H3,(H,27,33)(H,28,32)/t17-/m0/s1 |
| InChIKey | DCVVDWIKGGHWTK-KRWDZBQOSA-N |
| XLogP | 5.41 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.50 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|