C25H27ClIN5O2S — CID 126355124
4-chloro-N-[(1R)-1-[5-[2-(4-iodo-2-propan-2-ylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 126355124) has the molecular formula C25H27ClIN5O2S and a molecular weight of 623.95 g/mol. Its IUPAC name is 4-chloro-N-[(1R)-1-[5-[2-(4-iodo-2-propan-2-ylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | 4-chloro-N-[(1R)-1-[5-[2-(4-iodo-2-propan-2-ylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 126355124 |
| Molecular Formula | C25H27ClIN5O2S |
| Molecular Weight | 623.95 g/mol |
| Exact Mass | 623.06 |
| IUPAC Name | 4-chloro-N-[(1R)-1-[5-[2-(4-iodo-2-propan-2-ylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(I)cc2C(C)C)nnc1[C@@H](C)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H27ClIN5O2S/c1-5-12-32-23(16(4)28-24(34)17-6-8-18(26)9-7-17)30-31-25(32)35-14-22(33)29-21-11-10-19(27)13-20(21)15(2)3/h5-11,13,15-16H,1,12,14H2,2-4H3,(H,28,34)(H,29,33)/t16-/m1/s1 |
| InChIKey | PULFGAGPJAHWTC-MRXNPFEDSA-N |
| XLogP | 6.07 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.95 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|