C24H26ClIN4OS2 — CID 126368485
2-[[5-[(4-chlorophenyl)methylsulfanylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-iodo-2-propan-2-ylphenyl)acetamide (PubChem CID 126368485) has the molecular formula C24H26ClIN4OS2 and a molecular weight of 612.99 g/mol. Its IUPAC name is 2-[[5-[(4-chlorophenyl)methylsulfanylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-iodo-2-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[[5-[(4-chlorophenyl)methylsulfanylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-iodo-2-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 126368485 |
| Molecular Formula | C24H26ClIN4OS2 |
| Molecular Weight | 612.99 g/mol |
| Exact Mass | 612.03 |
| IUPAC Name | 2-[[5-[(4-chlorophenyl)methylsulfanylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-iodo-2-propan-2-ylphenyl)acetamide |
| SMILES | C=CCn1c(CSCc2ccc(Cl)cc2)nnc1SCC(=O)Nc1ccc(I)cc1C(C)C |
| InChI | InChI=1S/C24H26ClIN4OS2/c1-4-11-30-22(14-32-13-17-5-7-18(25)8-6-17)28-29-24(30)33-15-23(31)27-21-10-9-19(26)12-20(21)16(2)3/h4-10,12,16H,1,11,13-15H2,2-3H3,(H,27,31) |
| InChIKey | VHPRKCAQCOJETJ-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.99 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|