C24H25Cl2IN4OS2 — CID 126368424
2-[[5-[(3,4-dichlorophenyl)methylsulfanylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-iodo-2-propan-2-ylphenyl)acetamide (PubChem CID 126368424) has the molecular formula C24H25Cl2IN4OS2 and a molecular weight of 647.44 g/mol. Its IUPAC name is 2-[[5-[(3,4-dichlorophenyl)methylsulfanylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-iodo-2-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[[5-[(3,4-dichlorophenyl)methylsulfanylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-iodo-2-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 126368424 |
| Molecular Formula | C24H25Cl2IN4OS2 |
| Molecular Weight | 647.44 g/mol |
| Exact Mass | 645.99 |
| IUPAC Name | 2-[[5-[(3,4-dichlorophenyl)methylsulfanylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-iodo-2-propan-2-ylphenyl)acetamide |
| SMILES | C=CCn1c(CSCc2ccc(Cl)c(Cl)c2)nnc1SCC(=O)Nc1ccc(I)cc1C(C)C |
| InChI | InChI=1S/C24H25Cl2IN4OS2/c1-4-9-31-22(13-33-12-16-5-7-19(25)20(26)10-16)29-30-24(31)34-14-23(32)28-21-8-6-17(27)11-18(21)15(2)3/h4-8,10-11,15H,1,9,12-14H2,2-3H3,(H,28,32) |
| InChIKey | UWLPTRNOPQUOIF-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.44 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|