C22H21Cl2IN4OS2 — CID 126363969
2-[[5-[(3,4-dichlorophenyl)methylsulfanylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-iodo-2-methylphenyl)acetamide (PubChem CID 126363969) has the molecular formula C22H21Cl2IN4OS2 and a molecular weight of 619.38 g/mol. Its IUPAC name is 2-[[5-[(3,4-dichlorophenyl)methylsulfanylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-iodo-2-methylphenyl)acetamide.
| Compound Name | 2-[[5-[(3,4-dichlorophenyl)methylsulfanylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-iodo-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126363969 |
| Molecular Formula | C22H21Cl2IN4OS2 |
| Molecular Weight | 619.38 g/mol |
| Exact Mass | 617.96 |
| IUPAC Name | 2-[[5-[(3,4-dichlorophenyl)methylsulfanylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-iodo-2-methylphenyl)acetamide |
| SMILES | C=CCn1c(CSCc2ccc(Cl)c(Cl)c2)nnc1SCC(=O)Nc1ccc(I)cc1C |
| InChI | InChI=1S/C22H21Cl2IN4OS2/c1-3-8-29-20(12-31-11-15-4-6-17(23)18(24)10-15)27-28-22(29)32-13-21(30)26-19-7-5-16(25)9-14(19)2/h3-7,9-10H,1,8,11-13H2,2H3,(H,26,30) |
| InChIKey | HIDXWDCYXZGPII-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.38 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|