C22H23IN4OS2 — CID 126368418
N-(4-iodophenyl)-2-[[5-[(4-methylphenyl)methylsulfanylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 126368418) has the molecular formula C22H23IN4OS2 and a molecular weight of 550.49 g/mol. Its IUPAC name is N-(4-iodophenyl)-2-[[5-[(4-methylphenyl)methylsulfanylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(4-iodophenyl)-2-[[5-[(4-methylphenyl)methylsulfanylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 126368418 |
| Molecular Formula | C22H23IN4OS2 |
| Molecular Weight | 550.49 g/mol |
| Exact Mass | 550.04 |
| IUPAC Name | N-(4-iodophenyl)-2-[[5-[(4-methylphenyl)methylsulfanylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(CSCc2ccc(C)cc2)nnc1SCC(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C22H23IN4OS2/c1-3-12-27-20(14-29-13-17-6-4-16(2)5-7-17)25-26-22(27)30-15-21(28)24-19-10-8-18(23)9-11-19/h3-11H,1,12-15H2,2H3,(H,24,28) |
| InChIKey | UTTNIUIKIDEZNZ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|