C21H19Cl2IN4OS2 — CID 126365793
2-[[5-[(2,4-dichlorophenyl)methylsulfanylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-iodophenyl)acetamide (PubChem CID 126365793) has the molecular formula C21H19Cl2IN4OS2 and a molecular weight of 605.35 g/mol. Its IUPAC name is 2-[[5-[(2,4-dichlorophenyl)methylsulfanylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[[5-[(2,4-dichlorophenyl)methylsulfanylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 126365793 |
| Molecular Formula | C21H19Cl2IN4OS2 |
| Molecular Weight | 605.35 g/mol |
| Exact Mass | 603.94 |
| IUPAC Name | 2-[[5-[(2,4-dichlorophenyl)methylsulfanylmethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-iodophenyl)acetamide |
| SMILES | C=CCn1c(CSCc2ccc(Cl)cc2Cl)nnc1SCC(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C21H19Cl2IN4OS2/c1-2-9-28-19(12-30-11-14-3-4-15(22)10-18(14)23)26-27-21(28)31-13-20(29)25-17-7-5-16(24)6-8-17/h2-8,10H,1,9,11-13H2,(H,25,29) |
| InChIKey | NMZRYDKAWQPQRY-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.35 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|