C22H24N4O2S2 — CID 126363914
2-[[5-(benzylsulfanylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methoxyphenyl)acetamide (PubChem CID 126363914) has the molecular formula C22H24N4O2S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is 2-[[5-(benzylsulfanylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[[5-(benzylsulfanylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126363914 |
| Molecular Formula | C22H24N4O2S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 2-[[5-(benzylsulfanylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methoxyphenyl)acetamide |
| SMILES | C=CCn1c(CSCc2ccccc2)nnc1SCC(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H24N4O2S2/c1-3-13-26-20(15-29-14-17-7-5-4-6-8-17)24-25-22(26)30-16-21(27)23-18-9-11-19(28-2)12-10-18/h3-12H,1,13-16H2,2H3,(H,23,27) |
| InChIKey | GXCCLNBKMJOAGB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|