C25H24N4OS2 — CID 126368360
2-[[5-(benzylsulfanylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-2-ylacetamide (PubChem CID 126368360) has the molecular formula C25H24N4OS2 and a molecular weight of 460.63 g/mol. Its IUPAC name is 2-[[5-(benzylsulfanylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[[5-(benzylsulfanylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 126368360 |
| Molecular Formula | C25H24N4OS2 |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 2-[[5-(benzylsulfanylmethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-2-ylacetamide |
| SMILES | C=CCn1c(CSCc2ccccc2)nnc1SCC(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H24N4OS2/c1-2-14-29-23(17-31-16-19-8-4-3-5-9-19)27-28-25(29)32-18-24(30)26-22-13-12-20-10-6-7-11-21(20)15-22/h2-13,15H,1,14,16-18H2,(H,26,30) |
| InChIKey | UIFPXVQBUCRMAZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|