C23H22Cl2IN5O2S — CID 124587080
2,4-dichloro-N-[(1S)-1-[5-[2-(4-iodo-2-methylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 124587080) has the molecular formula C23H22Cl2IN5O2S and a molecular weight of 630.34 g/mol. Its IUPAC name is 2,4-dichloro-N-[(1S)-1-[5-[2-(4-iodo-2-methylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[(1S)-1-[5-[2-(4-iodo-2-methylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 124587080 |
| Molecular Formula | C23H22Cl2IN5O2S |
| Molecular Weight | 630.34 g/mol |
| Exact Mass | 628.99 |
| IUPAC Name | 2,4-dichloro-N-[(1S)-1-[5-[2-(4-iodo-2-methylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(I)cc2C)nnc1[C@H](C)NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H22Cl2IN5O2S/c1-4-9-31-21(14(3)27-22(33)17-7-5-15(24)11-18(17)25)29-30-23(31)34-12-20(32)28-19-8-6-16(26)10-13(19)2/h4-8,10-11,14H,1,9,12H2,2-3H3,(H,27,33)(H,28,32)/t14-/m0/s1 |
| InChIKey | HCECNRRDBWAQKW-AWEZNQCLSA-N |
| XLogP | 5.91 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.34 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|