C15H16Cl2N4OS — CID 7725629
2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N,N-dimethylacetamide (PubChem CID 7725629) has the molecular formula C15H16Cl2N4OS and a molecular weight of 371.29 g/mol. Its IUPAC name is 2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N,N-dimethylacetamide.
| Compound Name | 2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 7725629 |
| Molecular Formula | C15H16Cl2N4OS |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 2-[[5-(2,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N,N-dimethylacetamide |
| SMILES | C=CCn1c(SCC(=O)N(C)C)nnc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H16Cl2N4OS/c1-4-7-21-14(11-6-5-10(16)8-12(11)17)18-19-15(21)23-9-13(22)20(2)3/h4-6,8H,1,7,9H2,2-3H3 |
| InChIKey | UZSVSWJPHTXTFQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|